![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 3.3.1-Screen-corresp..> | 2023-02-21 10:26 | 15M | |
| 3.3.1-Screen-corresp..> | 2023-02-21 10:27 | 14M | |
| 3.3.1-Screen-corresp..> | 2023-02-21 10:27 | 13M | |
| 3.3.1-Screen-corresp..> | 2023-02-21 10:27 | 8.2M | |
| 5.2.1-Screen-Finding..> | 2023-02-21 10:27 | 90M | |
| 5.3.1-Screen-BF and ..> | 2023-02-21 10:27 | 29M | |
| 5.4.1-Screen-dSTROM ..> | 2023-02-21 10:28 | 246M | |
| 5.5.1 camera setting..> | 2023-03-30 05:13 | 8.3M | |
| 5.6.1_Run annalysis_..> | 2023-03-30 05:13 | 8.9M | |
| 5.6.1_Run annalysis ..> | 2023-03-30 05:13 | 9.3M | |
| Final script with ki..> | 2023-02-21 10:29 | 95K | |