![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 61382_Li_Voiceover/ | 2021-04-03 00:42 | - | |
| 61382_R3.docx | 2020-05-07 20:56 | 101K | |
| 61382fig01.jpg | 2020-05-11 23:28 | 115K | |
| 61382fig01large.jpg | 2020-05-11 23:28 | 376K | |
| 61382fig02.jpg | 2020-05-11 23:28 | 205K | |
| 61382fig02large.jpg | 2020-05-11 23:28 | 257K | |
| 61382fig03.jpg | 2020-05-11 23:28 | 71K | |
| 61382fig03large.jpg | 2020-05-11 23:29 | 256K | |
| Copy of JoVE_Table_o..> | 2020-05-07 20:56 | 12K | |
| IC50_step5-7_CBSD.mp4 | 2020-10-22 15:00 | 271M | |
| IC50 step1 & PDX Org..> | 2020-10-22 15:00 | 2.9G | |
| IC50 step1 & PDX Org..> | 2020-10-23 00:43 | 633M | |
| IC50 step4_CBSD.mp4 | 2020-10-22 15:00 | 152M | |
| JOVE Figures draft-f..> | 2020-05-07 20:56 | 1.0M | |
| JoVE61382.pdf | 2020-05-07 20:56 | 2.5M | |
| JoVE61382.xml | 2020-05-07 20:56 | 9.3K | |
| Jove_Author_Comment_..> | 2020-06-22 14:58 | 103K | |
| Jove_Author_Video_Co..> | 2021-03-31 04:52 | 84K | |
| PDX Organoid step5-6..> | 2020-10-22 15:00 | 2.5G | |
| PDX Organoid step5-6..> | 2020-10-23 00:43 | 577M | |
| response to the Edit..> | 2020-05-07 20:56 | 24K | |