![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 60335 Peviani redo 1..> | 2019-09-18 00:28 | - | |
| 60335_Francisco_Este..> | 2019-09-26 20:10 | 15M | |
| 60335_Marc_Peviani.jpg | 2019-09-26 20:10 | 15M | |
| 60335_R1_RE.docx | 2019-07-24 17:31 | 80K | |
| 60335_Voiceover/ | 2019-08-22 00:28 | - | |
| 60335fig01.jpg | 2019-08-01 13:31 | 192K | |
| 60335fig01large.jpg | 2019-07-30 12:00 | 969K | |
| 60335fig02.jpg | 2019-08-01 13:31 | 193K | |
| 60335fig02large.jpg | 2019-07-30 12:00 | 838K | |
| 60335fig03.jpg | 2019-08-01 13:31 | 189K | |
| 60335fig03large.jpg | 2019-07-30 12:00 | 697K | |
| 60335fig04.jpg | 2019-08-01 13:31 | 90K | |
| 60335fig04large.jpg | 2019-07-30 12:00 | 385K | |
| 20190707_183411.jpg | 2019-08-03 21:21 | 3.5M | |
| 20190707_183425.jpg | 2019-08-03 21:21 | 1.5M | |
| 20190707_183500.jpg | 2019-08-03 21:21 | 307K | |
| 20190707_183531.jpg | 2019-08-03 21:21 | 502K | |
| 20190707_183546.jpg | 2019-08-03 21:21 | 536K | |
| 20190707_183555.jpg | 2019-08-03 21:21 | 349K | |
| 20190707_183556.jpg | 2019-08-03 21:21 | 356K | |
| Author_License_Agree..> | 2019-07-24 17:31 | 752K | |
| Brain_after_percoll_..> | 2019-08-16 22:47 | 3.1M | |
| Cover letter with an..> | 2019-07-24 17:31 | 489K | |
| Figure 1.tif | 2019-07-24 17:31 | 21M | |
| Figure 2.tif | 2019-07-24 17:31 | 21M | |
| Figure 3.tif | 2019-07-24 17:31 | 21M | |
| Figure 4.tif | 2019-07-24 17:31 | 11M | |
| JoVE60335.pdf | 2019-07-24 17:31 | 3.8M | |
| JoVE60335.xml | 2019-07-24 17:31 | 11K | |
| Jove_Author rough cu..> | 2019-09-12 11:25 | 118K | |
| Material and Reagent..> | 2019-07-24 17:31 | 17K | |
| SpinalCord_after_per..> | 2019-08-16 22:47 | 3.0M | |
| Table 1 revised.xlsx | 2019-07-24 17:31 | 11K | |
| Table 2 FINAL.xlsx | 2019-07-24 17:31 | 16K | |
| thumbnail/ | 2019-08-16 22:47 | - | |