![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 60130_5.13_t1.mp4 | 2019-05-27 06:02 | 2.9M | |
| 60130_5.18_t1.mp4 | 2019-05-27 06:02 | 1.0M | |
| 60130_5.19_t1.mp4 | 2019-05-27 06:02 | 1.2M | |
| 60130_Chi-Keung_Chen..> | 2019-08-27 16:07 | 552K | |
| 60130_Margaret_H_L_N..> | 2019-08-27 16:07 | 825K | |
| 60130_Ng_Voiceover/ | 2019-07-04 00:27 | - | |
| 60130_R1.docx | 2019-05-22 17:45 | 85K | |
| 60130fig1.jpg | 2019-05-29 18:47 | 78K | |
| 60130fig1large.jpg | 2019-05-29 18:47 | 151K | |
| 60130fig2.jpg | 2019-05-29 18:47 | 145K | |
| 60130fig2large.jpg | 2019-05-29 18:47 | 290K | |
| 60130fig3.jpg | 2019-05-29 18:47 | 110K | |
| 60130fig3large.jpg | 2019-05-29 18:47 | 186K | |
| Figure 1_TIFF.tif | 2019-05-22 17:45 | 9.3M | |
| Figure 2_TIFF.tif | 2019-05-22 17:45 | 9.6M | |
| Figure 3_TIFF.tif | 2019-05-22 17:45 | 9.5M | |
| JoVE60130.pdf | 2019-05-22 17:45 | 4.2M | |
| JoVE60130.xml | 2019-05-22 17:45 | 12K | |
| Jove_Author-revision..> | 2019-08-12 05:07 | 150K | |
| License agreement.pdf | 2019-05-22 17:45 | 1.6M | |
| Molecular Cancer edi..> | 2019-05-22 17:45 | 14K | |
| Response letter to J..> | 2019-05-22 17:45 | 30K | |
| Table of Materials-r..> | 2019-05-22 17:45 | 16K | |